C16H18O4 — CID 134889511
dimethyl (1S,2S,7R,8R)-tricyclo[6.2.2.02,7]dodeca-4,9,11-triene-9,10-dicarboxylate (PubChem CID 134889511) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is dimethyl (1S,2S,7R,8R)-tricyclo[6.2.2.02,7]dodeca-4,9,11-triene-9,10-dicarboxylate.
| Compound Name | dimethyl (1S,2S,7R,8R)-tricyclo[6.2.2.02,7]dodeca-4,9,11-triene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 134889511 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | dimethyl (1S,2S,7R,8R)-tricyclo[6.2.2.02,7]dodeca-4,9,11-triene-9,10-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H]2C=C[C@H]1[C@H]1CC=CC[C@H]12 |
| InChI | InChI=1S/C16H18O4/c1-19-15(17)13-11-7-8-12(14(13)16(18)20-2)10-6-4-3-5-9(10)11/h3-4,7-12H,5-6H2,1-2H3/t9-,10+,11-,12+ |
| InChIKey | DJERKGVHQHHRGU-BKUVIOGVSA-N |
| XLogP | 2.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|