C12H20BClO2 — CID 134889620
(2R,6S)-4-[(1R)-1-chloroethyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (PubChem CID 134889620) has the molecular formula C12H20BClO2 and a molecular weight of 242.55 g/mol. Its IUPAC name is (2R,6S)-4-[(1R)-1-chloroethyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane.
| Compound Name | (2R,6S)-4-[(1R)-1-chloroethyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
|---|---|
| PubChem CID | 134889620 |
| Molecular Formula | C12H20BClO2 |
| Molecular Weight | 242.55 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (2R,6S)-4-[(1R)-1-chloroethyl]-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| SMILES | C[C@H](Cl)B1O[C@H]2CC3CC(C3(C)C)[C@@]2(C)O1 |
| InChI | InChI=1S/C12H20BClO2/c1-7(14)13-15-10-6-8-5-9(11(8,2)3)12(10,4)16-13/h7-10H,5-6H2,1-4H3/t7-,8?,9?,10-,12+/m0/s1 |
| InChIKey | LNJGJPHOEZVFMM-JUSQZNFGSA-N |
| XLogP | 2.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|