About copper(1+);2-[(3S)-oct-1-en-3-yl]oxyoxane
copper(1+);2-[(3S)-oct-1-en-3-yl]oxyoxane (PubChem CID 134889915) has the molecular formula C13H23CuO2
and a molecular weight of 274.87 g/mol. Its IUPAC name is copper(1+);2-[(3S)-oct-1-en-3-yl]oxyoxane.
Molecular Properties
| Compound Name | copper(1+);2-[(3S)-oct-1-en-3-yl]oxyoxane |
| PubChem CID | 134889915 |
| Molecular Formula | C13H23CuO2 |
| Molecular Weight | 274.87 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | copper(1+);2-[(3S)-oct-1-en-3-yl]oxyoxane |
| SMILES | [Cu+].[H]/[C-]=C\[C@H](CCCCC)OC1CCCCO1 |
| InChI | InChI=1S/C13H23O2.Cu/c1-3-5-6-9-12(4-2)15-13-10-7-8-11-14-13;/h2,4,12-13H,3,5-11H2,1H3;/q-1;+1/t12-,13?;/m1./s1 |
| InChIKey | IFNVJDBAIDOALL-QPWPOBFOSA-N |
| XLogP | 3.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.87 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);2-[(3S)-oct-1-en-3-yl]oxyoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);2-[(3S)-oct-1-en-3-yl]oxyoxane?
The IUPAC name of copper(1+);2-[(3S)-oct-1-en-3-yl]oxyoxane (CID 134889915) is copper(1+);2-[(3S)-oct-1-en-3-yl]oxyoxane.
What is the SMILES notation for copper(1+);2-[(3S)-oct-1-en-3-yl]oxyoxane?
The canonical SMILES for copper(1+);2-[(3S)-oct-1-en-3-yl]oxyoxane is [Cu+].[H]/[C-]=C\[C@H](CCCCC)OC1CCCCO1.
What is the InChIKey of copper(1+);2-[(3S)-oct-1-en-3-yl]oxyoxane?
The InChIKey is IFNVJDBAIDOALL-QPWPOBFOSA-N. The full InChI is InChI=1S/C13H23O2.Cu/c1-3-5-6-9-12(4-2)15-13-10-7-8-11-14-13;/h2,4,12-13H,3,5-11H2,1H3;/q-1;+1/t12-,13?;/m1./s1.
What are the key properties of copper(1+);2-[(3S)-oct-1-en-3-yl]oxyoxane?
copper(1+);2-[(3S)-oct-1-en-3-yl]oxyoxane has a molecular weight of 274.87 g/mol, XLogP of 3.47, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);2-[(3S)-oct-1-en-3-yl]oxyoxane is sourced from PubChem (CID 134889915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).