C11H18O3 — CID 134890133
1-[(9R)-9-methyl-1,4-dioxaspiro[4.5]decan-6-yl]ethanone (PubChem CID 134890133) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 1-[(9R)-9-methyl-1,4-dioxaspiro[4.5]decan-6-yl]ethanone.
| Compound Name | 1-[(9R)-9-methyl-1,4-dioxaspiro[4.5]decan-6-yl]ethanone |
|---|---|
| PubChem CID | 134890133 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 1-[(9R)-9-methyl-1,4-dioxaspiro[4.5]decan-6-yl]ethanone |
| SMILES | CC(=O)C1CC[C@@H](C)CC12OCCO2 |
| InChI | InChI=1S/C11H18O3/c1-8-3-4-10(9(2)12)11(7-8)13-5-6-14-11/h8,10H,3-7H2,1-2H3/t8-,10?/m1/s1 |
| InChIKey | ZAIFRYFYSQOLRT-HNHGDDPOSA-N |
| XLogP | 1.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |