C12H16O3 — CID 86062897
7-but-2-ynyl-1,4-dioxaspiro[4.5]decan-8-one (PubChem CID 86062897) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 7-but-2-ynyl-1,4-dioxaspiro[4.5]decan-8-one.
| Compound Name | 7-but-2-ynyl-1,4-dioxaspiro[4.5]decan-8-one |
|---|---|
| PubChem CID | 86062897 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 7-but-2-ynyl-1,4-dioxaspiro[4.5]decan-8-one |
| SMILES | CC#CCC1CC2(CCC1=O)OCCO2 |
| InChI | InChI=1S/C12H16O3/c1-2-3-4-10-9-12(6-5-11(10)13)14-7-8-15-12/h10H,4-9H2,1H3 |
| InChIKey | AZRQPUWTVYHSEM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|