About [(1E)-2-ethynylpenta-1,4-dienyl]-bis(prop-2-enyl)borane
[(1E)-2-ethynylpenta-1,4-dienyl]-bis(prop-2-enyl)borane (PubChem CID 134890537) has the molecular formula C13H17B
and a molecular weight of 184.09 g/mol. Its IUPAC name is [(1E)-2-ethynylpenta-1,4-dienyl]-bis(prop-2-enyl)borane.
Molecular Properties
| Compound Name | [(1E)-2-ethynylpenta-1,4-dienyl]-bis(prop-2-enyl)borane |
| PubChem CID | 134890537 |
| Molecular Formula | C13H17B |
| Molecular Weight | 184.09 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | [(1E)-2-ethynylpenta-1,4-dienyl]-bis(prop-2-enyl)borane |
| SMILES | C#C/C(=C/B(CC=C)CC=C)CC=C |
| InChI | InChI=1S/C13H17B/c1-5-9-13(8-4)12-14(10-6-2)11-7-3/h4-7,12H,1-3,9-11H2/b13-12- |
| InChIKey | OCRCIMMECQBUEC-SEYXRHQNSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.09 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1E)-2-ethynylpenta-1,4-dienyl]-bis(prop-2-enyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E)-2-ethynylpenta-1,4-dienyl]-bis(prop-2-enyl)borane?
The IUPAC name of [(1E)-2-ethynylpenta-1,4-dienyl]-bis(prop-2-enyl)borane (CID 134890537) is [(1E)-2-ethynylpenta-1,4-dienyl]-bis(prop-2-enyl)borane.
What is the SMILES notation for [(1E)-2-ethynylpenta-1,4-dienyl]-bis(prop-2-enyl)borane?
The canonical SMILES for [(1E)-2-ethynylpenta-1,4-dienyl]-bis(prop-2-enyl)borane is C#C/C(=C/B(CC=C)CC=C)CC=C.
What is the InChIKey of [(1E)-2-ethynylpenta-1,4-dienyl]-bis(prop-2-enyl)borane?
The InChIKey is OCRCIMMECQBUEC-SEYXRHQNSA-N. The full InChI is InChI=1S/C13H17B/c1-5-9-13(8-4)12-14(10-6-2)11-7-3/h4-7,12H,1-3,9-11H2/b13-12-.
What are the key properties of [(1E)-2-ethynylpenta-1,4-dienyl]-bis(prop-2-enyl)borane?
[(1E)-2-ethynylpenta-1,4-dienyl]-bis(prop-2-enyl)borane has a molecular weight of 184.09 g/mol, XLogP of 3.53, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E)-2-ethynylpenta-1,4-dienyl]-bis(prop-2-enyl)borane is sourced from PubChem (CID 134890537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).