About [(2Z)-2-(4,5-dimethyldiselenol-3-ylidene)propylidene]-dimethylazanium
[(2Z)-2-(4,5-dimethyldiselenol-3-ylidene)propylidene]-dimethylazanium (PubChem CID 134891007) has the molecular formula C10H16NSe2+
and a molecular weight of 308.17 g/mol. Its IUPAC name is [(2Z)-2-(4,5-dimethyldiselenol-3-ylidene)propylidene]-dimethylazanium.
Molecular Properties
| Compound Name | [(2Z)-2-(4,5-dimethyldiselenol-3-ylidene)propylidene]-dimethylazanium |
| PubChem CID | 134891007 |
| Molecular Formula | C10H16NSe2+ |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 309.96 |
| IUPAC Name | [(2Z)-2-(4,5-dimethyldiselenol-3-ylidene)propylidene]-dimethylazanium |
| SMILES | CC1=C(C)/C(=C(\C)C=[N+](C)C)[Se][Se]1 |
| InChI | InChI=1S/C10H16NSe2/c1-7(6-11(4)5)10-8(2)9(3)12-13-10/h6H,1-5H3/q+1/b10-7- |
| InChIKey | WHXBQBXVMZMSPS-YFHOEESVSA-N |
| XLogP | 1.23 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-2-(4,5-dimethyldiselenol-3-ylidene)propylidene]-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-2-(4,5-dimethyldiselenol-3-ylidene)propylidene]-dimethylazanium?
The IUPAC name of [(2Z)-2-(4,5-dimethyldiselenol-3-ylidene)propylidene]-dimethylazanium (CID 134891007) is [(2Z)-2-(4,5-dimethyldiselenol-3-ylidene)propylidene]-dimethylazanium.
What is the SMILES notation for [(2Z)-2-(4,5-dimethyldiselenol-3-ylidene)propylidene]-dimethylazanium?
The canonical SMILES for [(2Z)-2-(4,5-dimethyldiselenol-3-ylidene)propylidene]-dimethylazanium is CC1=C(C)/C(=C(\C)C=[N+](C)C)[Se][Se]1.
What is the InChIKey of [(2Z)-2-(4,5-dimethyldiselenol-3-ylidene)propylidene]-dimethylazanium?
The InChIKey is WHXBQBXVMZMSPS-YFHOEESVSA-N. The full InChI is InChI=1S/C10H16NSe2/c1-7(6-11(4)5)10-8(2)9(3)12-13-10/h6H,1-5H3/q+1/b10-7-.
What are the key properties of [(2Z)-2-(4,5-dimethyldiselenol-3-ylidene)propylidene]-dimethylazanium?
[(2Z)-2-(4,5-dimethyldiselenol-3-ylidene)propylidene]-dimethylazanium has a molecular weight of 308.17 g/mol, XLogP of 1.23, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-2-(4,5-dimethyldiselenol-3-ylidene)propylidene]-dimethylazanium is sourced from PubChem (CID 134891007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).