C14H30ClN2P — CID 134891357
[1-[1-(dimethylamino)-2,2-dimethylpropylidene]phosphanyl-2,2-dimethylpropylidene]-dimethylazanium chloride (PubChem CID 134891357) has the molecular formula C14H30ClN2P and a molecular weight of 292.84 g/mol. Its IUPAC name is [1-[1-(dimethylamino)-2,2-dimethylpropylidene]phosphanyl-2,2-dimethylpropylidene]-dimethylazanium chloride.
| Compound Name | [1-[1-(dimethylamino)-2,2-dimethylpropylidene]phosphanyl-2,2-dimethylpropylidene]-dimethylazanium chloride |
|---|---|
| PubChem CID | 134891357 |
| Molecular Formula | C14H30ClN2P |
| Molecular Weight | 292.84 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | [1-[1-(dimethylamino)-2,2-dimethylpropylidene]phosphanyl-2,2-dimethylpropylidene]-dimethylazanium chloride |
| SMILES | CN(C)/C(=P/C(=[N+](C)C)C(C)(C)C)C(C)(C)C.[Cl-] |
| InChI | InChI=1S/C14H30N2P.ClH/c1-13(2,3)11(15(7)8)17-12(16(9)10)14(4,5)6;/h1-10H3;1H/q+1;/p-1 |
| InChIKey | GYDQSTRSWGQXNQ-UHFFFAOYSA-M |
| XLogP | 0.39 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.84 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|