C7H7F6N — CID 134891491
1,1,1,3,3,3-hexafluoro-N-(2-methylprop-1-enyl)propan-2-imine (PubChem CID 134891491) has the molecular formula C7H7F6N and a molecular weight of 219.13 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-N-(2-methylprop-1-enyl)propan-2-imine.
| Compound Name | 1,1,1,3,3,3-hexafluoro-N-(2-methylprop-1-enyl)propan-2-imine |
|---|---|
| PubChem CID | 134891491 |
| Molecular Formula | C7H7F6N |
| Molecular Weight | 219.13 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-N-(2-methylprop-1-enyl)propan-2-imine |
| SMILES | CC(C)=CN=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H7F6N/c1-4(2)3-14-5(6(8,9)10)7(11,12)13/h3H,1-2H3 |
| InChIKey | JVGZXVSBIMUJFP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.13 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|