C6H5F6N — CID 134891490
1,1,1,3,3,3-hexafluoro-N-[(E)-prop-1-enyl]propan-2-imine (PubChem CID 134891490) has the molecular formula C6H5F6N and a molecular weight of 205.10 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-N-[(E)-prop-1-enyl]propan-2-imine.
| Compound Name | 1,1,1,3,3,3-hexafluoro-N-[(E)-prop-1-enyl]propan-2-imine |
|---|---|
| PubChem CID | 134891490 |
| Molecular Formula | C6H5F6N |
| Molecular Weight | 205.10 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-N-[(E)-prop-1-enyl]propan-2-imine |
| SMILES | C/C=C/N=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H5F6N/c1-2-3-13-4(5(7,8)9)6(10,11)12/h2-3H,1H3/b3-2+ |
| InChIKey | JUQDHRKRBJBNFW-NSCUHMNNSA-N |
| XLogP | 3.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.10 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|