C6H9F2N — CID 164958696
1,1-difluoro-N-[(E)-prop-1-enyl]propan-2-imine (PubChem CID 164958696) has the molecular formula C6H9F2N and a molecular weight of 133.14 g/mol. Its IUPAC name is 1,1-difluoro-N-[(E)-prop-1-enyl]propan-2-imine.
| Compound Name | 1,1-difluoro-N-[(E)-prop-1-enyl]propan-2-imine |
|---|---|
| PubChem CID | 164958696 |
| Molecular Formula | C6H9F2N |
| Molecular Weight | 133.14 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | 1,1-difluoro-N-[(E)-prop-1-enyl]propan-2-imine |
| SMILES | C/C=C/N=C(\C)C(F)F |
| InChI | InChI=1S/C6H9F2N/c1-3-4-9-5(2)6(7)8/h3-4,6H,1-2H3/b4-3+,9-5+ |
| InChIKey | BNKUFUSGYNHPAM-PRKJJMSOSA-N |
| XLogP | 2.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.14 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|