C13H14Br2O2 — CID 134892462
cis-(1R,2R)-2-bromo-2-(4-bromophenyl)cyclohexane-1-carboxylic acid (PubChem CID 134892462) has the molecular formula C13H14Br2O2 and a molecular weight of 362.06 g/mol. Its IUPAC name is cis-(1R,2R)-2-bromo-2-(4-bromophenyl)cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1R,2R)-2-bromo-2-(4-bromophenyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 134892462 |
| Molecular Formula | C13H14Br2O2 |
| Molecular Weight | 362.06 g/mol |
| Exact Mass | 359.94 |
| IUPAC Name | cis-(1R,2R)-2-bromo-2-(4-bromophenyl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCC[C@]1(Br)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H14Br2O2/c14-10-6-4-9(5-7-10)13(15)8-2-1-3-11(13)12(16)17/h4-7,11H,1-3,8H2,(H,16,17)/t11-,13+/m1/s1 |
| InChIKey | QSCMHFHACGINRB-YPMHNXCESA-N |
| XLogP | 4.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.06 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|