C18H24BrNO2 — CID 122030564
4-[[1-(4-bromophenyl)cyclobutyl]methylamino]cyclohexane-1-carboxylic acid (PubChem CID 122030564) has the molecular formula C18H24BrNO2 and a molecular weight of 366.30 g/mol. Its IUPAC name is 4-[[1-(4-bromophenyl)cyclobutyl]methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[1-(4-bromophenyl)cyclobutyl]methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122030564 |
| Molecular Formula | C18H24BrNO2 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 4-[[1-(4-bromophenyl)cyclobutyl]methylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NCC2(c3ccc(Br)cc3)CCC2)CC1 |
| InChI | InChI=1S/C18H24BrNO2/c19-15-6-4-14(5-7-15)18(10-1-11-18)12-20-16-8-2-13(3-9-16)17(21)22/h4-7,13,16,20H,1-3,8-12H2,(H,21,22) |
| InChIKey | MAPZDQBCPFYXNA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |