C21H31NO2 — CID 122030435
4-[[1-(3-methylphenyl)cyclohexyl]methylamino]cyclohexane-1-carboxylic acid (PubChem CID 122030435) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is 4-[[1-(3-methylphenyl)cyclohexyl]methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[1-(3-methylphenyl)cyclohexyl]methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122030435 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 4-[[1-(3-methylphenyl)cyclohexyl]methylamino]cyclohexane-1-carboxylic acid |
| SMILES | Cc1cccc(C2(CNC3CCC(C(=O)O)CC3)CCCCC2)c1 |
| InChI | InChI=1S/C21H31NO2/c1-16-6-5-7-18(14-16)21(12-3-2-4-13-21)15-22-19-10-8-17(9-11-19)20(23)24/h5-7,14,17,19,22H,2-4,8-13,15H2,1H3,(H,23,24) |
| InChIKey | UMWGZLWFOARXMG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |