C13H28O4Si — CID 134892479
(3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)pentanal (PubChem CID 134892479) has the molecular formula C13H28O4Si and a molecular weight of 276.45 g/mol. Its IUPAC name is (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)pentanal.
| Compound Name | (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)pentanal |
|---|---|
| PubChem CID | 134892479 |
| Molecular Formula | C13H28O4Si |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)pentanal |
| SMILES | COCO[C@@H](CC=O)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H28O4Si/c1-11(12(8-9-14)16-10-15-5)17-18(6,7)13(2,3)4/h9,11-12H,8,10H2,1-7H3/t11-,12-/m0/s1 |
| InChIKey | ATQOHGBOAUQJOI-RYUDHWBXSA-N |
| XLogP | 2.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|