C13H15NO4 — CID 134892566
(3R,4R)-1-benzyl-3,4-dimethoxypyrrolidine-2,5-dione (PubChem CID 134892566) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-3,4-dimethoxypyrrolidine-2,5-dione.
| Compound Name | (3R,4R)-1-benzyl-3,4-dimethoxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 134892566 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (3R,4R)-1-benzyl-3,4-dimethoxypyrrolidine-2,5-dione |
| SMILES | CO[C@H]1C(=O)N(Cc2ccccc2)C(=O)[C@@H]1OC |
| InChI | InChI=1S/C13H15NO4/c1-17-10-11(18-2)13(16)14(12(10)15)8-9-6-4-3-5-7-9/h3-7,10-11H,8H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | OOEMSENBHZKYJI-GHMZBOCLSA-N |
| XLogP | 0.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|