About CID 134893222
CID 134893222 (PubChem CID 134893222) has the molecular formula C16H28PRh
and a molecular weight of 354.28 g/mol.
Molecular Properties
| Compound Name | CID 134893222 |
| PubChem CID | 134893222 |
| Molecular Formula | C16H28PRh |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | — |
| SMILES | C=C=[Rh].CC(C)P(C(C)C)C(C)C.[CH]1C=CC=C1 |
| InChI | InChI=1S/C9H21P.C5H5.C2H2.Rh/c1-7(2)10(8(3)4)9(5)6;1-2-4-5-3-1;1-2;/h7-9H,1-6H3;1-5H;1H2; |
| InChIKey | HCWYGJZTKJRLJR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 134893222 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134893222?
The IUPAC name of CID 134893222 (CID 134893222) is not available.
What is the SMILES notation for CID 134893222?
The canonical SMILES for CID 134893222 is C=C=[Rh].CC(C)P(C(C)C)C(C)C.[CH]1C=CC=C1.
What is the InChIKey of CID 134893222?
The InChIKey is HCWYGJZTKJRLJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21P.C5H5.C2H2.Rh/c1-7(2)10(8(3)4)9(5)6;1-2-4-5-3-1;1-2;/h7-9H,1-6H3;1-5H;1H2;.
What are the key properties of CID 134893222?
CID 134893222 has a molecular weight of 354.28 g/mol, XLogP of 5.13, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134893222 is sourced from PubChem (CID 134893222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).