C10H22N2O4 — CID 134893274
(3S,4S,5R,6R)-2-(butylamino)-6-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 134893274) has the molecular formula C10H22N2O4 and a molecular weight of 234.30 g/mol. Its IUPAC name is (3S,4S,5R,6R)-2-(butylamino)-6-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (3S,4S,5R,6R)-2-(butylamino)-6-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 134893274 |
| Molecular Formula | C10H22N2O4 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (3S,4S,5R,6R)-2-(butylamino)-6-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | CCCCNC1N[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H22N2O4/c1-2-3-4-11-10-9(16)8(15)7(14)6(5-13)12-10/h6-16H,2-5H2,1H3/t6-,7-,8+,9-,10?/m1/s1 |
| InChIKey | VYCYPLBUSLBVKU-ZKZCYXTQSA-N |
| XLogP | -2.25 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|