C12H14O7 — CID 134893345
4-[2-[2-(2,4-dioxobut-3-enoxy)ethoxy]ethoxy]but-1-ene-1,3-dione (PubChem CID 134893345) has the molecular formula C12H14O7 and a molecular weight of 270.24 g/mol. Its IUPAC name is 4-[2-[2-(2,4-dioxobut-3-enoxy)ethoxy]ethoxy]but-1-ene-1,3-dione.
| Compound Name | 4-[2-[2-(2,4-dioxobut-3-enoxy)ethoxy]ethoxy]but-1-ene-1,3-dione |
|---|---|
| PubChem CID | 134893345 |
| Molecular Formula | C12H14O7 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-[2-[2-(2,4-dioxobut-3-enoxy)ethoxy]ethoxy]but-1-ene-1,3-dione |
| SMILES | O=C=CC(=O)COCCOCCOCC(=O)C=C=O |
| InChI | InChI=1S/C12H14O7/c13-3-1-11(15)9-18-7-5-17-6-8-19-10-12(16)2-4-14/h1-2H,5-10H2 |
| InChIKey | NATWPFNWAUELGY-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|