C10H20O3Si — CID 134893592
[(E,1S)-1-trimethylsilylbut-2-enyl] 2-methoxyacetate (PubChem CID 134893592) has the molecular formula C10H20O3Si and a molecular weight of 216.35 g/mol. Its IUPAC name is [(E,1S)-1-trimethylsilylbut-2-enyl] 2-methoxyacetate.
| Compound Name | [(E,1S)-1-trimethylsilylbut-2-enyl] 2-methoxyacetate |
|---|---|
| PubChem CID | 134893592 |
| Molecular Formula | C10H20O3Si |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | [(E,1S)-1-trimethylsilylbut-2-enyl] 2-methoxyacetate |
| SMILES | C/C=C/[C@@H](OC(=O)COC)[Si](C)(C)C |
| InChI | InChI=1S/C10H20O3Si/c1-6-7-10(14(3,4)5)13-9(11)8-12-2/h6-7,10H,8H2,1-5H3/b7-6+/t10-/m0/s1 |
| InChIKey | RNMUAZKLCFONDU-FGEFZZPRSA-N |
| XLogP | 2.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|