C11H14FNO2 — CID 134893613
2-fluoro-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]acetamide (PubChem CID 134893613) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is 2-fluoro-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]acetamide.
| Compound Name | 2-fluoro-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]acetamide |
|---|---|
| PubChem CID | 134893613 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-fluoro-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]acetamide |
| SMILES | C[C@H](NC(=O)CF)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C11H14FNO2/c1-8(13-10(14)7-12)11(15)9-5-3-2-4-6-9/h2-6,8,11,15H,7H2,1H3,(H,13,14)/t8-,11+/m0/s1 |
| InChIKey | LVVJIMMJQIQXIK-GZMMTYOYSA-N |
| XLogP | 1.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |