C13H26O3Si — CID 134894371
trimethyl-[2-[[(2R)-1-(oxiran-2-yl)pent-4-en-2-yl]oxymethoxy]ethyl]silane (PubChem CID 134894371) has the molecular formula C13H26O3Si and a molecular weight of 258.43 g/mol. Its IUPAC name is trimethyl-[2-[[(2R)-1-(oxiran-2-yl)pent-4-en-2-yl]oxymethoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[(2R)-1-(oxiran-2-yl)pent-4-en-2-yl]oxymethoxy]ethyl]silane |
|---|---|
| PubChem CID | 134894371 |
| Molecular Formula | C13H26O3Si |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | trimethyl-[2-[[(2R)-1-(oxiran-2-yl)pent-4-en-2-yl]oxymethoxy]ethyl]silane |
| SMILES | C=CC[C@H](CC1CO1)OCOCC[Si](C)(C)C |
| InChI | InChI=1S/C13H26O3Si/c1-5-6-12(9-13-10-15-13)16-11-14-7-8-17(2,3)4/h5,12-13H,1,6-11H2,2-4H3/t12-,13?/m1/s1 |
| InChIKey | AGVPQHWYRPXYMJ-PZORYLMUSA-N |
| XLogP | 3.05 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|