C12H19NO2 — CID 134894534
3-(2,2-dimethylpropanoyl)-1-ethenyl-3-methylpyrrolidin-2-one (PubChem CID 134894534) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 3-(2,2-dimethylpropanoyl)-1-ethenyl-3-methylpyrrolidin-2-one.
| Compound Name | 3-(2,2-dimethylpropanoyl)-1-ethenyl-3-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 134894534 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 3-(2,2-dimethylpropanoyl)-1-ethenyl-3-methylpyrrolidin-2-one |
| SMILES | C=CN1CCC(C)(C(=O)C(C)(C)C)C1=O |
| InChI | InChI=1S/C12H19NO2/c1-6-13-8-7-12(5,10(13)15)9(14)11(2,3)4/h6H,1,7-8H2,2-5H3 |
| InChIKey | VSSDPBRCVMFUEK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|