C10H17NO — CID 18175994
1-ethenyl-3,3-diethylpyrrolidin-2-one (PubChem CID 18175994) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 1-ethenyl-3,3-diethylpyrrolidin-2-one.
| Compound Name | 1-ethenyl-3,3-diethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 18175994 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 1-ethenyl-3,3-diethylpyrrolidin-2-one |
| SMILES | C=CN1CCC(CC)(CC)C1=O |
| InChI | InChI=1S/C10H17NO/c1-4-10(5-2)7-8-11(6-3)9(10)12/h6H,3-5,7-8H2,1-2H3 |
| InChIKey | YVXKHPHLMBCHCV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |