C12H18O3 — CID 134894759
4-butyl-3,4-dimethoxycyclohexa-2,5-dien-1-one (PubChem CID 134894759) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 4-butyl-3,4-dimethoxycyclohexa-2,5-dien-1-one.
| Compound Name | 4-butyl-3,4-dimethoxycyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 134894759 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 4-butyl-3,4-dimethoxycyclohexa-2,5-dien-1-one |
| SMILES | CCCCC1(OC)C=CC(=O)C=C1OC |
| InChI | InChI=1S/C12H18O3/c1-4-5-7-12(15-3)8-6-10(13)9-11(12)14-2/h6,8-9H,4-5,7H2,1-3H3 |
| InChIKey | WEJBAIMSSQUILB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |