C13H15F3O — CID 134895147
[(E)-4-ethoxy-5,5,5-trifluoropent-3-enyl]benzene (PubChem CID 134895147) has the molecular formula C13H15F3O and a molecular weight of 244.26 g/mol. Its IUPAC name is [(E)-4-ethoxy-5,5,5-trifluoropent-3-enyl]benzene.
| Compound Name | [(E)-4-ethoxy-5,5,5-trifluoropent-3-enyl]benzene |
|---|---|
| PubChem CID | 134895147 |
| Molecular Formula | C13H15F3O |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | [(E)-4-ethoxy-5,5,5-trifluoropent-3-enyl]benzene |
| SMILES | CCO/C(=C/CCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H15F3O/c1-2-17-12(13(14,15)16)10-6-9-11-7-4-3-5-8-11/h3-5,7-8,10H,2,6,9H2,1H3/b12-10+ |
| InChIKey | NXYAHAFYBOJIDB-ZRDIBKRKSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|