C12H23FO2Si — CID 134895597
(4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-fluorocyclopent-2-en-1-ol (PubChem CID 134895597) has the molecular formula C12H23FO2Si and a molecular weight of 246.40 g/mol. Its IUPAC name is (4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-fluorocyclopent-2-en-1-ol.
| Compound Name | (4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-fluorocyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 134895597 |
| Molecular Formula | C12H23FO2Si |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (4R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-fluorocyclopent-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]1(F)C=CC(O)C1 |
| InChI | InChI=1S/C12H23FO2Si/c1-11(2,3)16(4,5)15-9-12(13)7-6-10(14)8-12/h6-7,10,14H,8-9H2,1-5H3/t10?,12-/m0/s1 |
| InChIKey | VPEBKMWLGMDTLZ-KFJBMODSSA-N |
| XLogP | 3.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|