C13H16OS — CID 134895893
(1R,5R)-5-(phenylsulfanylmethyl)cyclohex-2-en-1-ol (PubChem CID 134895893) has the molecular formula C13H16OS and a molecular weight of 220.34 g/mol. Its IUPAC name is (1R,5R)-5-(phenylsulfanylmethyl)cyclohex-2-en-1-ol.
| Compound Name | (1R,5R)-5-(phenylsulfanylmethyl)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 134895893 |
| Molecular Formula | C13H16OS |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | (1R,5R)-5-(phenylsulfanylmethyl)cyclohex-2-en-1-ol |
| SMILES | O[C@H]1C=CC[C@@H](CSc2ccccc2)C1 |
| InChI | InChI=1S/C13H16OS/c14-12-6-4-5-11(9-12)10-15-13-7-2-1-3-8-13/h1-4,6-8,11-12,14H,5,9-10H2/t11-,12+/m1/s1 |
| InChIKey | JMQNXJWUUCVPDG-NEPJUHHUSA-N |
| XLogP | 3.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|