C16H22OS — CID 585064
2,6,6-trimethyl-3-phenylsulfanylcyclohept-4-en-1-ol (PubChem CID 585064) has the molecular formula C16H22OS and a molecular weight of 262.42 g/mol. Its IUPAC name is 2,6,6-trimethyl-3-phenylsulfanylcyclohept-4-en-1-ol.
| Compound Name | 2,6,6-trimethyl-3-phenylsulfanylcyclohept-4-en-1-ol |
|---|---|
| PubChem CID | 585064 |
| Molecular Formula | C16H22OS |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2,6,6-trimethyl-3-phenylsulfanylcyclohept-4-en-1-ol |
| SMILES | CC1C(O)CC(C)(C)C=CC1Sc1ccccc1 |
| InChI | InChI=1S/C16H22OS/c1-12-14(17)11-16(2,3)10-9-15(12)18-13-7-5-4-6-8-13/h4-10,12,14-15,17H,11H2,1-3H3 |
| InChIKey | JBPWPAJSDNRTMV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|