C12H14O7 — CID 134895968
[(2S)-2-acetyloxy-4-methyl-6-oxo-1,3-dioxin-2-yl]methyl but-3-enoate (PubChem CID 134895968) has the molecular formula C12H14O7 and a molecular weight of 270.24 g/mol. Its IUPAC name is [(2S)-2-acetyloxy-4-methyl-6-oxo-1,3-dioxin-2-yl]methyl but-3-enoate.
| Compound Name | [(2S)-2-acetyloxy-4-methyl-6-oxo-1,3-dioxin-2-yl]methyl but-3-enoate |
|---|---|
| PubChem CID | 134895968 |
| Molecular Formula | C12H14O7 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | [(2S)-2-acetyloxy-4-methyl-6-oxo-1,3-dioxin-2-yl]methyl but-3-enoate |
| SMILES | C=CCC(=O)OC[C@]1(OC(C)=O)OC(=O)C=C(C)O1 |
| InChI | InChI=1S/C12H14O7/c1-4-5-10(14)16-7-12(18-9(3)13)17-8(2)6-11(15)19-12/h4,6H,1,5,7H2,2-3H3/t12-/m0/s1 |
| InChIKey | MJNJIALERUBKAM-LBPRGKRZSA-N |
| XLogP | 0.80 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|