About 4-[iodo(dimethyl)-λ4-selanyl]-6-phenylhexan-1-ol
4-[iodo(dimethyl)-λ4-selanyl]-6-phenylhexan-1-ol (PubChem CID 134896664) has the molecular formula C14H23IOSe
and a molecular weight of 413.20 g/mol. Its IUPAC name is 4-[iodo(dimethyl)-λ4-selanyl]-6-phenylhexan-1-ol.
Molecular Properties
| Compound Name | 4-[iodo(dimethyl)-λ4-selanyl]-6-phenylhexan-1-ol |
| PubChem CID | 134896664 |
| Molecular Formula | C14H23IOSe |
| Molecular Weight | 413.20 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | 4-[iodo(dimethyl)-λ4-selanyl]-6-phenylhexan-1-ol |
| SMILES | C[Se](C)(I)C(CCCO)CCc1ccccc1 |
| InChI | InChI=1S/C14H23IOSe/c1-17(2,15)14(9-6-12-16)11-10-13-7-4-3-5-8-13/h3-5,7-8,14,16H,6,9-12H2,1-2H3 |
| InChIKey | WONAEFZYXOIRIG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.20 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-[iodo(dimethyl)-λ4-selanyl]-6-phenylhexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[iodo(dimethyl)-λ4-selanyl]-6-phenylhexan-1-ol?
The IUPAC name of 4-[iodo(dimethyl)-λ4-selanyl]-6-phenylhexan-1-ol (CID 134896664) is 4-[iodo(dimethyl)-λ4-selanyl]-6-phenylhexan-1-ol.
What is the SMILES notation for 4-[iodo(dimethyl)-λ4-selanyl]-6-phenylhexan-1-ol?
The canonical SMILES for 4-[iodo(dimethyl)-λ4-selanyl]-6-phenylhexan-1-ol is C[Se](C)(I)C(CCCO)CCc1ccccc1.
What is the InChIKey of 4-[iodo(dimethyl)-λ4-selanyl]-6-phenylhexan-1-ol?
The InChIKey is WONAEFZYXOIRIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23IOSe/c1-17(2,15)14(9-6-12-16)11-10-13-7-4-3-5-8-13/h3-5,7-8,14,16H,6,9-12H2,1-2H3.
What are the key properties of 4-[iodo(dimethyl)-λ4-selanyl]-6-phenylhexan-1-ol?
4-[iodo(dimethyl)-λ4-selanyl]-6-phenylhexan-1-ol has a molecular weight of 413.20 g/mol, XLogP of 4.40, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[iodo(dimethyl)-λ4-selanyl]-6-phenylhexan-1-ol is sourced from PubChem (CID 134896664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).