About disodium;5-[2-[2-(2-oxidoethoxy)ethoxy]ethoxy]pentan-1-olate
disodium;5-[2-[2-(2-oxidoethoxy)ethoxy]ethoxy]pentan-1-olate (PubChem CID 134896706) has the molecular formula C11H22Na2O5
and a molecular weight of 280.27 g/mol. Its IUPAC name is disodium;5-[2-[2-(2-oxidoethoxy)ethoxy]ethoxy]pentan-1-olate.
Molecular Properties
| Compound Name | disodium;5-[2-[2-(2-oxidoethoxy)ethoxy]ethoxy]pentan-1-olate |
| PubChem CID | 134896706 |
| Molecular Formula | C11H22Na2O5 |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | disodium;5-[2-[2-(2-oxidoethoxy)ethoxy]ethoxy]pentan-1-olate |
| SMILES | [Na+].[Na+].[O-]CCCCCOCCOCCOCC[O-] |
| InChI | InChI=1S/C11H22O5.2Na/c12-4-2-1-3-6-14-8-10-16-11-9-15-7-5-13;;/h1-11H2;;/q-2;2*+1 |
| InChIKey | VZCNGJMFBYESCX-UHFFFAOYSA-N |
| XLogP | -7.06 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | -7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze disodium;5-[2-[2-(2-oxidoethoxy)ethoxy]ethoxy]pentan-1-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;5-[2-[2-(2-oxidoethoxy)ethoxy]ethoxy]pentan-1-olate?
The IUPAC name of disodium;5-[2-[2-(2-oxidoethoxy)ethoxy]ethoxy]pentan-1-olate (CID 134896706) is disodium;5-[2-[2-(2-oxidoethoxy)ethoxy]ethoxy]pentan-1-olate.
What is the SMILES notation for disodium;5-[2-[2-(2-oxidoethoxy)ethoxy]ethoxy]pentan-1-olate?
The canonical SMILES for disodium;5-[2-[2-(2-oxidoethoxy)ethoxy]ethoxy]pentan-1-olate is [Na+].[Na+].[O-]CCCCCOCCOCCOCC[O-].
What is the InChIKey of disodium;5-[2-[2-(2-oxidoethoxy)ethoxy]ethoxy]pentan-1-olate?
The InChIKey is VZCNGJMFBYESCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O5.2Na/c12-4-2-1-3-6-14-8-10-16-11-9-15-7-5-13;;/h1-11H2;;/q-2;2*+1.
What are the key properties of disodium;5-[2-[2-(2-oxidoethoxy)ethoxy]ethoxy]pentan-1-olate?
disodium;5-[2-[2-(2-oxidoethoxy)ethoxy]ethoxy]pentan-1-olate has a molecular weight of 280.27 g/mol, XLogP of -7.06, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;5-[2-[2-(2-oxidoethoxy)ethoxy]ethoxy]pentan-1-olate is sourced from PubChem (CID 134896706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).