C9H9Cl4O3P — CID 134897580
[chloro(2,2,2-trichloroethoxy)phosphoryl]oxymethylbenzene (PubChem CID 134897580) has the molecular formula C9H9Cl4O3P and a molecular weight of 337.95 g/mol. Its IUPAC name is [chloro(2,2,2-trichloroethoxy)phosphoryl]oxymethylbenzene.
| Compound Name | [chloro(2,2,2-trichloroethoxy)phosphoryl]oxymethylbenzene |
|---|---|
| PubChem CID | 134897580 |
| Molecular Formula | C9H9Cl4O3P |
| Molecular Weight | 337.95 g/mol |
| Exact Mass | 335.90 |
| IUPAC Name | [chloro(2,2,2-trichloroethoxy)phosphoryl]oxymethylbenzene |
| SMILES | O=P(Cl)(OCc1ccccc1)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H9Cl4O3P/c10-9(11,12)7-16-17(13,14)15-6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | FOZGOBUCYXFYCR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.95 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|