C8H7Cl4O3P — CID 134897537
[chloro(2,2,2-trichloroethoxy)phosphoryl]oxybenzene (PubChem CID 134897537) has the molecular formula C8H7Cl4O3P and a molecular weight of 323.93 g/mol. Its IUPAC name is [chloro(2,2,2-trichloroethoxy)phosphoryl]oxybenzene.
| Compound Name | [chloro(2,2,2-trichloroethoxy)phosphoryl]oxybenzene |
|---|---|
| PubChem CID | 134897537 |
| Molecular Formula | C8H7Cl4O3P |
| Molecular Weight | 323.93 g/mol |
| Exact Mass | 321.89 |
| IUPAC Name | [chloro(2,2,2-trichloroethoxy)phosphoryl]oxybenzene |
| SMILES | O=P(Cl)(OCC(Cl)(Cl)Cl)Oc1ccccc1 |
| InChI | InChI=1S/C8H7Cl4O3P/c9-8(10,11)6-14-16(12,13)15-7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | UJVKUIJDMOFJDJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.93 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|