C11H14O4 — CID 134897894
ethyl 2-[(1R,2S,5R)-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-2-yl]acetate (PubChem CID 134897894) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is ethyl 2-[(1R,2S,5R)-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-2-yl]acetate.
| Compound Name | ethyl 2-[(1R,2S,5R)-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-2-yl]acetate |
|---|---|
| PubChem CID | 134897894 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | ethyl 2-[(1R,2S,5R)-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-2-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1C(=O)C[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C11H14O4/c1-2-14-11(13)6-8-9(12)5-7-3-4-10(8)15-7/h3-4,7-8,10H,2,5-6H2,1H3/t7-,8+,10+/m0/s1 |
| InChIKey | SKSPHZAQAWMMEC-QXFUBDJGSA-N |
| XLogP | 0.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|