C16H24O4 — CID 15922318
ethyl 5-[(1R,2R,4S,5S)-2,4-dimethyl-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-1-yl]pentanoate (PubChem CID 15922318) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is ethyl 5-[(1R,2R,4S,5S)-2,4-dimethyl-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-1-yl]pentanoate.
| Compound Name | ethyl 5-[(1R,2R,4S,5S)-2,4-dimethyl-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-1-yl]pentanoate |
|---|---|
| PubChem CID | 15922318 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | ethyl 5-[(1R,2R,4S,5S)-2,4-dimethyl-3-oxo-8-oxabicyclo[3.2.1]oct-6-en-1-yl]pentanoate |
| SMILES | CCOC(=O)CCCC[C@]12C=C[C@H](O1)[C@H](C)C(=O)[C@@H]2C |
| InChI | InChI=1S/C16H24O4/c1-4-19-14(17)7-5-6-9-16-10-8-13(20-16)11(2)15(18)12(16)3/h8,10-13H,4-7,9H2,1-3H3/t11-,12-,13-,16+/m0/s1 |
| InChIKey | MUPQFGCNJPVYDT-WFGGJUAMSA-N |
| XLogP | 2.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|