C14H22O2 — CID 134897991
4-butyl-6,7-dimethylocta-4,5-dien-2-yne-1,7-diol (PubChem CID 134897991) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 4-butyl-6,7-dimethylocta-4,5-dien-2-yne-1,7-diol.
| Compound Name | 4-butyl-6,7-dimethylocta-4,5-dien-2-yne-1,7-diol |
|---|---|
| PubChem CID | 134897991 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 4-butyl-6,7-dimethylocta-4,5-dien-2-yne-1,7-diol |
| SMILES | CCCCC(=C=C(C)C(C)(C)O)C#CCO |
| InChI | InChI=1S/C14H22O2/c1-5-6-8-13(9-7-10-15)11-12(2)14(3,4)16/h15-16H,5-6,8,10H2,1-4H3 |
| InChIKey | HHJRMHSJGIOUGR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|