C17H26O2 — CID 11010793
(2Z)-6-butyl-3,8,9-trimethyldeca-2,6,7-trien-4-yne-1,9-diol (PubChem CID 11010793) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is (2Z)-6-butyl-3,8,9-trimethyldeca-2,6,7-trien-4-yne-1,9-diol.
| Compound Name | (2Z)-6-butyl-3,8,9-trimethyldeca-2,6,7-trien-4-yne-1,9-diol |
|---|---|
| PubChem CID | 11010793 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | (2Z)-6-butyl-3,8,9-trimethyldeca-2,6,7-trien-4-yne-1,9-diol |
| SMILES | CCCCC(=C=C(C)C(C)(C)O)C#C/C(C)=C\CO |
| InChI | InChI=1S/C17H26O2/c1-6-7-8-16(10-9-14(2)11-12-18)13-15(3)17(4,5)19/h11,18-19H,6-8,12H2,1-5H3/b14-11- |
| InChIKey | UCYFTBKBVXUTQZ-KAMYIIQDSA-N |
| XLogP | 3.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|