C18H26O2 — CID 15860151
(E)-7-methyl-5-[(E)-non-1-en-3-ynyl]oct-5-en-3-yne-1,7-diol (PubChem CID 15860151) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (E)-7-methyl-5-[(E)-non-1-en-3-ynyl]oct-5-en-3-yne-1,7-diol.
| Compound Name | (E)-7-methyl-5-[(E)-non-1-en-3-ynyl]oct-5-en-3-yne-1,7-diol |
|---|---|
| PubChem CID | 15860151 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (E)-7-methyl-5-[(E)-non-1-en-3-ynyl]oct-5-en-3-yne-1,7-diol |
| SMILES | CCCCCC#C/C=C/C(C#CCCO)=C\C(C)(C)O |
| InChI | InChI=1S/C18H26O2/c1-4-5-6-7-8-9-10-13-17(14-11-12-15-19)16-18(2,3)20/h10,13,16,19-20H,4-7,12,15H2,1-3H3/b13-10+,17-16+ |
| InChIKey | WFVYALQRECVYIC-VTRAWOOYSA-N |
| XLogP | 3.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|