C12H20O2 — CID 71534139
(E,5R,6R)-2,5,7-trimethylnon-7-en-3-yne-2,6-diol (PubChem CID 71534139) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (E,5R,6R)-2,5,7-trimethylnon-7-en-3-yne-2,6-diol.
| Compound Name | (E,5R,6R)-2,5,7-trimethylnon-7-en-3-yne-2,6-diol |
|---|---|
| PubChem CID | 71534139 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (E,5R,6R)-2,5,7-trimethylnon-7-en-3-yne-2,6-diol |
| SMILES | C/C=C(\C)[C@H](O)[C@H](C)C#CC(C)(C)O |
| InChI | InChI=1S/C12H20O2/c1-6-9(2)11(13)10(3)7-8-12(4,5)14/h6,10-11,13-14H,1-5H3/b9-6+/t10-,11+/m1/s1 |
| InChIKey | RFBRSNGJUQPENB-FSZCPTMNSA-N |
| XLogP | 1.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|