C21H34O9 — CID 134899708
tetraethyl 3-acetyl-1-methylhexane-1,1,5,5-tetracarboxylate (PubChem CID 134899708) has the molecular formula C21H34O9 and a molecular weight of 430.49 g/mol. Its IUPAC name is tetraethyl 3-acetyl-1-methylhexane-1,1,5,5-tetracarboxylate.
| Compound Name | tetraethyl 3-acetyl-1-methylhexane-1,1,5,5-tetracarboxylate |
|---|---|
| PubChem CID | 134899708 |
| Molecular Formula | C21H34O9 |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | tetraethyl 3-acetyl-1-methylhexane-1,1,5,5-tetracarboxylate |
| SMILES | CCOC(=O)C(C)(CC(CC(C)(C(=O)OCC)C(=O)OCC)C(C)=O)C(=O)OCC |
| InChI | InChI=1S/C21H34O9/c1-8-27-16(23)20(6,17(24)28-9-2)12-15(14(5)22)13-21(7,18(25)29-10-3)19(26)30-11-4/h15H,8-13H2,1-7H3 |
| InChIKey | AUGAOMKGBYCCNE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|