C23H20BrN3O5S — CID 13489983
N-(4-bromophenyl)-4-[dimethylsulfamoyl-(3-oxo-1H-2-benzofuran-1-yl)amino]benzamide (PubChem CID 13489983) has the molecular formula C23H20BrN3O5S and a molecular weight of 530.40 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-[dimethylsulfamoyl-(3-oxo-1H-2-benzofuran-1-yl)amino]benzamide.
| Compound Name | N-(4-bromophenyl)-4-[dimethylsulfamoyl-(3-oxo-1H-2-benzofuran-1-yl)amino]benzamide |
|---|---|
| PubChem CID | 13489983 |
| Molecular Formula | C23H20BrN3O5S |
| Molecular Weight | 530.40 g/mol |
| Exact Mass | 529.03 |
| IUPAC Name | N-(4-bromophenyl)-4-[dimethylsulfamoyl-(3-oxo-1H-2-benzofuran-1-yl)amino]benzamide |
| SMILES | CN(C)S(=O)(=O)N(c1ccc(C(=O)Nc2ccc(Br)cc2)cc1)C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C23H20BrN3O5S/c1-26(2)33(30,31)27(22-19-5-3-4-6-20(19)23(29)32-22)18-13-7-15(8-14-18)21(28)25-17-11-9-16(24)10-12-17/h3-14,22H,1-2H3,(H,25,28) |
| InChIKey | JDAHUHJPSHQGQZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |