C19H25N3O3S — CID 53283134
4-[dimethylsulfamoyl(methyl)amino]-N-(4-propan-2-ylphenyl)benzamide (PubChem CID 53283134) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is 4-[dimethylsulfamoyl(methyl)amino]-N-(4-propan-2-ylphenyl)benzamide.
| Compound Name | 4-[dimethylsulfamoyl(methyl)amino]-N-(4-propan-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 53283134 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 4-[dimethylsulfamoyl(methyl)amino]-N-(4-propan-2-ylphenyl)benzamide |
| SMILES | CC(C)c1ccc(NC(=O)c2ccc(N(C)S(=O)(=O)N(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H25N3O3S/c1-14(2)15-6-10-17(11-7-15)20-19(23)16-8-12-18(13-9-16)22(5)26(24,25)21(3)4/h6-14H,1-5H3,(H,20,23) |
| InChIKey | JZYMAJQGVKBMKK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |