About methyl 3-phenylprop-2-ynoate;bis(rhodium);hexakis(trifluorophosphane)
methyl 3-phenylprop-2-ynoate;bis(rhodium);hexakis(trifluorophosphane) (PubChem CID 134899942) has the molecular formula C10H8F18O2P6Rh2
and a molecular weight of 893.79 g/mol. Its IUPAC name is methyl 3-phenylprop-2-ynoate;bis(rhodium);hexakis(trifluorophosphane).
Molecular Properties
| Compound Name | methyl 3-phenylprop-2-ynoate;bis(rhodium);hexakis(trifluorophosphane) |
| PubChem CID | 134899942 |
| Molecular Formula | C10H8F18O2P6Rh2 |
| Molecular Weight | 893.79 g/mol |
| Exact Mass | 893.68 |
| IUPAC Name | methyl 3-phenylprop-2-ynoate;bis(rhodium);hexakis(trifluorophosphane) |
| SMILES | COC(=O)C#Cc1ccccc1.FP(F)F.FP(F)F.FP(F)F.FP(F)F.FP(F)F.FP(F)F.[Rh].[Rh] |
| InChI | InChI=1S/C10H8O2.6F3P.2Rh/c1-12-10(11)8-7-9-5-3-2-4-6-9;6*1-4(2)3;;/h2-6H,1H3;;;;;;;; |
| InChIKey | OUULUMOUQZGEMG-UHFFFAOYSA-N |
| XLogP | 13.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 893.79 |
| LogP ≤ 5 | 13.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-phenylprop-2-ynoate;bis(rhodium);hexakis(trifluorophosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-phenylprop-2-ynoate;bis(rhodium);hexakis(trifluorophosphane)?
The IUPAC name of methyl 3-phenylprop-2-ynoate;bis(rhodium);hexakis(trifluorophosphane) (CID 134899942) is methyl 3-phenylprop-2-ynoate;bis(rhodium);hexakis(trifluorophosphane).
What is the SMILES notation for methyl 3-phenylprop-2-ynoate;bis(rhodium);hexakis(trifluorophosphane)?
The canonical SMILES for methyl 3-phenylprop-2-ynoate;bis(rhodium);hexakis(trifluorophosphane) is COC(=O)C#Cc1ccccc1.FP(F)F.FP(F)F.FP(F)F.FP(F)F.FP(F)F.FP(F)F.[Rh].[Rh].
What is the InChIKey of methyl 3-phenylprop-2-ynoate;bis(rhodium);hexakis(trifluorophosphane)?
The InChIKey is OUULUMOUQZGEMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2.6F3P.2Rh/c1-12-10(11)8-7-9-5-3-2-4-6-9;6*1-4(2)3;;/h2-6H,1H3;;;;;;;;.
What are the key properties of methyl 3-phenylprop-2-ynoate;bis(rhodium);hexakis(trifluorophosphane)?
methyl 3-phenylprop-2-ynoate;bis(rhodium);hexakis(trifluorophosphane) has a molecular weight of 893.79 g/mol, XLogP of 13.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-phenylprop-2-ynoate;bis(rhodium);hexakis(trifluorophosphane) is sourced from PubChem (CID 134899942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).