C20H20O2 — CID 12036893
(2,3,4,5,6-pentamethylphenyl) 3-phenylprop-2-ynoate (PubChem CID 12036893) has the molecular formula C20H20O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is (2,3,4,5,6-pentamethylphenyl) 3-phenylprop-2-ynoate.
| Compound Name | (2,3,4,5,6-pentamethylphenyl) 3-phenylprop-2-ynoate |
|---|---|
| PubChem CID | 12036893 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (2,3,4,5,6-pentamethylphenyl) 3-phenylprop-2-ynoate |
| SMILES | Cc1c(C)c(C)c(OC(=O)C#Cc2ccccc2)c(C)c1C |
| InChI | InChI=1S/C20H20O2/c1-13-14(2)16(4)20(17(5)15(13)3)22-19(21)12-11-18-9-7-6-8-10-18/h6-10H,1-5H3 |
| InChIKey | MMKKZCXCBDDZHJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|