C17H26O2 — CID 134900091
methyl (3aS,4Z,8aS)-4-(2,2-dimethylpropylidene)-2,3,3a,5,6,8a-hexahydro-1H-azulene-2-carboxylate (PubChem CID 134900091) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is methyl (3aS,4Z,8aS)-4-(2,2-dimethylpropylidene)-2,3,3a,5,6,8a-hexahydro-1H-azulene-2-carboxylate.
| Compound Name | methyl (3aS,4Z,8aS)-4-(2,2-dimethylpropylidene)-2,3,3a,5,6,8a-hexahydro-1H-azulene-2-carboxylate |
|---|---|
| PubChem CID | 134900091 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | methyl (3aS,4Z,8aS)-4-(2,2-dimethylpropylidene)-2,3,3a,5,6,8a-hexahydro-1H-azulene-2-carboxylate |
| SMILES | COC(=O)C1C[C@H]2C=CCC/C(=C/C(C)(C)C)[C@H]2C1 |
| InChI | InChI=1S/C17H26O2/c1-17(2,3)11-13-8-6-5-7-12-9-14(10-15(12)13)16(18)19-4/h5,7,11-12,14-15H,6,8-10H2,1-4H3/b13-11-/t12-,14?,15+/m1/s1 |
| InChIKey | OYPYHBCDTMFUDW-CRGDAJMOSA-N |
| XLogP | 4.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|