C15H22O3 — CID 134900445
methyl (1R,5R)-5-[(1R)-1-methyl-2-oxocyclohexyl]cyclohex-3-ene-1-carboxylate (PubChem CID 134900445) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is methyl (1R,5R)-5-[(1R)-1-methyl-2-oxocyclohexyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,5R)-5-[(1R)-1-methyl-2-oxocyclohexyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 134900445 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | methyl (1R,5R)-5-[(1R)-1-methyl-2-oxocyclohexyl]cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CC=C[C@H]([C@@]2(C)CCCCC2=O)C1 |
| InChI | InChI=1S/C15H22O3/c1-15(9-4-3-8-13(15)16)12-7-5-6-11(10-12)14(17)18-2/h5,7,11-12H,3-4,6,8-10H2,1-2H3/t11-,12+,15-/m1/s1 |
| InChIKey | DDNABEMUPBKLIW-TYNCELHUSA-N |
| XLogP | 2.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|