C9H12 — CID 134900896
(1S,6R)-tricyclo[4.2.1.02,5]non-2(5)-ene (PubChem CID 134900896) has the molecular formula C9H12 and a molecular weight of 120.19 g/mol. Its IUPAC name is (1S,6R)-tricyclo[4.2.1.02,5]non-2(5)-ene.
| Compound Name | (1S,6R)-tricyclo[4.2.1.02,5]non-2(5)-ene |
|---|---|
| PubChem CID | 134900896 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | (1S,6R)-tricyclo[4.2.1.02,5]non-2(5)-ene |
| SMILES | C1CC2=C1[C@@H]1CC[C@H]2C1 |
| InChI | InChI=1S/C9H12/c1-2-7-5-6(1)8-3-4-9(7)8/h6-7H,1-5H2/t6-,7+ |
| InChIKey | GKYMZAJXGNOYBX-KNVOCYPGSA-N |
| XLogP | 2.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|