C27H38OSi — CID 134900912
3-methyl-5-[methyl(diphenyl)silyl]tridec-1-en-4-one (PubChem CID 134900912) has the molecular formula C27H38OSi and a molecular weight of 406.69 g/mol. Its IUPAC name is 3-methyl-5-[methyl(diphenyl)silyl]tridec-1-en-4-one.
| Compound Name | 3-methyl-5-[methyl(diphenyl)silyl]tridec-1-en-4-one |
|---|---|
| PubChem CID | 134900912 |
| Molecular Formula | C27H38OSi |
| Molecular Weight | 406.69 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 3-methyl-5-[methyl(diphenyl)silyl]tridec-1-en-4-one |
| SMILES | C=CC(C)C(=O)C(CCCCCCCC)[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H38OSi/c1-5-7-8-9-10-17-22-26(27(28)23(3)6-2)29(4,24-18-13-11-14-19-24)25-20-15-12-16-21-25/h6,11-16,18-21,23,26H,2,5,7-10,17,22H2,1,3-4H3 |
| InChIKey | YPZABNOEMFCVLF-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.69 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|