C23H10AgBF18N6 — CID 134901373
silver;ethynylbenzene;tris[3,5-bis(trifluoromethyl)pyrazol-1-yl]boranuide (PubChem CID 134901373) has the molecular formula C23H10AgBF18N6 and a molecular weight of 831.02 g/mol. Its IUPAC name is silver;ethynylbenzene;tris[3,5-bis(trifluoromethyl)pyrazol-1-yl]boranuide.
| Compound Name | silver;ethynylbenzene;tris[3,5-bis(trifluoromethyl)pyrazol-1-yl]boranuide |
|---|---|
| PubChem CID | 134901373 |
| Molecular Formula | C23H10AgBF18N6 |
| Molecular Weight | 831.02 g/mol |
| Exact Mass | 829.98 |
| IUPAC Name | silver;ethynylbenzene;tris[3,5-bis(trifluoromethyl)pyrazol-1-yl]boranuide |
| SMILES | C#Cc1ccccc1.FC(F)(F)c1cc(C(F)(F)F)n([BH-](n2nc(C(F)(F)F)cc2C(F)(F)F)n2nc(C(F)(F)F)cc2C(F)(F)F)n1.[Ag+] |
| InChI | InChI=1S/C15H4BF18N6.C8H6.Ag/c17-10(18,19)4-1-7(13(26,27)28)38(35-4)16(39-8(14(29,30)31)2-5(36-39)11(20,21)22)40-9(15(32,33)34)3-6(37-40)12(23,24)25;1-2-8-6-4-3-5-7-8;/h1-3,16H;1,3-7H;/q-1;;+1 |
| InChIKey | FGDREFCDHBAAFO-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.02 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|